Introduction：Basic information about CAS 480424-69-9|3-Acetoxyphenylboronic acid pinacol ester, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 3-Acetoxyphenylboronic acid pinacol ester |
|---|
| CAS Number | 480424-69-9 | Molecular Weight | 262.10900 |
|---|
| Density | 1.08g/cm3 | Boiling Point | 116-120ºC 0,03mm |
|---|
| Molecular Formula | C14H19BO4 | Melting Point | 36-40ºC(lit.) |
|---|
| MSDS | / | Flash Point | >230 °F |
|---|
Names
| Name | [3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl] acetate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.08g/cm3 |
|---|
| Boiling Point | 116-120ºC 0,03mm |
|---|
| Melting Point | 36-40ºC(lit.) |
|---|
| Molecular Formula | C14H19BO4 |
|---|
| Molecular Weight | 262.10900 |
|---|
| Flash Point | >230 °F |
|---|
| Exact Mass | 262.13800 |
|---|
| PSA | 44.76000 |
|---|
| LogP | 1.91110 |
|---|
| Index of Refraction | 1.498 |
|---|
| InChIKey | YJDMBSCTYDVXPH-UHFFFAOYSA-N |
|---|
| SMILES | CC(=O)Oc1cccc(B2OC(C)(C)C(C)(C)O2)c1 |
|---|
Safety Information
| Risk Phrases | 36/37/38 |
|---|
| Safety Phrases | 26-36/37/39 |
|---|
Synonyms
| MFCD03453061 |
| 3-Acetoxyphenylboronic acid pinacol ester |
| BM049 |
