Introduction：Basic information about CAS 27676-62-6|Antioxidant 3114, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Antioxidant 3114 |
|---|
| CAS Number | 27676-62-6 | Molecular Weight | 784.078 |
|---|
| Density | 1.1±0.1 g/cm3 | Boiling Point | 757.9±60.0 °C at 760 mmHg |
|---|
| Molecular Formula | C48H69N3O6 | Melting Point | 218-220 °C(lit.) |
|---|
| MSDS | / | Flash Point | 412.2±32.9 °C |
|---|
Names
| Name | Tris(3,5-di-tert-butyl-4-hydroxybenzyl) isocyanurate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.1±0.1 g/cm3 |
|---|
| Boiling Point | 757.9±60.0 °C at 760 mmHg |
|---|
| Melting Point | 218-220 °C(lit.) |
|---|
| Molecular Formula | C48H69N3O6 |
|---|
| Molecular Weight | 784.078 |
|---|
| Flash Point | 412.2±32.9 °C |
|---|
| Exact Mass | 783.518616 |
|---|
| PSA | 126.69000 |
|---|
| LogP | 10.34 |
|---|
| Vapour Pressure | 0.0±2.6 mmHg at 25°C |
|---|
| Index of Refraction | 1.567 |
|---|
| InChIKey | VNQNXQYZMPJLQX-UHFFFAOYSA-N |
|---|
| SMILES | CC(C)(C)c1cc(Cn2c(=O)n(Cc3cc(C(C)(C)C)c(O)c(C(C)(C)C)c3)c(=O)n(Cc3cc(C(C)(C)C)c(O)c(C(C)(C)C)c3)c2=O)cc(C(C)(C)C)c1O |
|---|
Safety Information
| Hazard Codes | Xn |
|---|
| WGK Germany | - |
|---|
| HS Code | 2933699090 |
|---|
Customs
| HS Code | 2933699090 |
|---|
| Summary | 2933699090 other compounds containing an unfused triazine ring (whether or not hydrogenated) in the structure。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:20.0% |
|---|
Synonyms
| Tris(3,5-di-tert-butyl-4-hydroxybenzyl) Isocyanurate |
| AgeRite GT |
| 1,3,5-Tris[4-hydroxy-3,5-bis(2-methyl-2-propanyl)benzyl]-1,3,5-triazinane-2,4,6-trione |
| Thanox3114 |
| RALOX 3114 |
| Antioxidant3114 |
| 1,3,5-Tris(3,5-di-tert-butyl-4-hydroxybenzyl)-1,3,5-triazine-2,4,6-(1H,3H,5H)-trione |
| Irganox 3114 FF |
| 1,3,5-Triazine-2,4,6(1H,3H,5H)-trione, 1,3,5-tris[[3,5-bis(1,1-dimethylethyl)-4-hydroxyphenyl]methyl]- |
| At 3114 |
| Goodrite 3114 |
| Mark AO-20 |
| EINECS 248-597-9 |
| VANOX GT |
| 1,3,5-Tris(3,5-di-tert-butyl-4-hydroxybenzyl)-1,3,5-triazinane-2,4,6-trione |
| IRGANOX 3114 |
| MFCD00134700 |
| Plastic additive 13 |
| TTIC |
| Antioxidant 3114 |
