Introduction：Basic information about CAS 933202-27-8|Methanone, [4-(3-chlorophenyl)-1-piperazinyl][3-(4-fluorophenyl)-5-methyl-4-isoxazol, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Methanone, [4-(3-chlorophenyl)-1-piperazinyl][3-(4-fluorophenyl)-5-methyl-4-isoxazolyl] |
|---|
| CAS Number | 933202-27-8 | Molecular Weight | 399.84600 |
|---|
| Density | 1.317g/cm3 | Boiling Point | 615.9ºC at 760 mmHg |
|---|
| Molecular Formula | C21H19ClFN3O2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 326.3ºC |
|---|
Names
| Name | Methanone, [4-(3-chlorophenyl)-1-piperazinyl][3-(4-fluorophenyl)-5-methyl-4-isoxazolyl] |
|---|
Chemical & Physical Properties
| Density | 1.317g/cm3 |
|---|
| Boiling Point | 615.9ºC at 760 mmHg |
|---|
| Molecular Formula | C21H19ClFN3O2 |
|---|
| Molecular Weight | 399.84600 |
|---|
| Flash Point | 326.3ºC |
|---|
| Exact Mass | 399.11500 |
|---|
| PSA | 49.58000 |
|---|
| LogP | 4.40780 |
|---|
| Index of Refraction | 1.603 |
|---|
| InChIKey | XUSXORTUBZRFOJ-UHFFFAOYSA-N |
|---|
| SMILES | Cc1onc(-c2ccc(F)cc2)c1C(=O)N1CCN(c2cccc(Cl)c2)CC1 |
|---|
