Introduction：Basic information about CAS 932876-24-9|Methanone, (3-ethyl-5-methyl-4-isoxazolyl)[4-(4-methoxyphenyl)-1-piperazinyl], including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Methanone, (3-ethyl-5-methyl-4-isoxazolyl)[4-(4-methoxyphenyl)-1-piperazinyl] |
|---|
| CAS Number | 932876-24-9 | Molecular Weight | 329.39400 |
|---|
| Density | 1.181g/cm3 | Boiling Point | 546.638ºC at 760 mmHg |
|---|
| Molecular Formula | C18H23N3O3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 284.397ºC |
|---|
Names
| Name | Methanone, (3-ethyl-5-methyl-4-isoxazolyl)[4-(4-methoxyphenyl)-1-piperazinyl] |
|---|
Chemical & Physical Properties
| Density | 1.181g/cm3 |
|---|
| Boiling Point | 546.638ºC at 760 mmHg |
|---|
| Molecular Formula | C18H23N3O3 |
|---|
| Molecular Weight | 329.39400 |
|---|
| Flash Point | 284.397ºC |
|---|
| Exact Mass | 329.17400 |
|---|
| PSA | 58.81000 |
|---|
| LogP | 2.51930 |
|---|
| Index of Refraction | 1.567 |
|---|
| InChIKey | PPYLPKNJUZKNBI-UHFFFAOYSA-N |
|---|
| SMILES | CCc1noc(C)c1C(=O)N1CCN(c2ccc(OC)cc2)CC1 |
|---|
