Introduction：Basic information about CAS 932813-53-1|Methanone, (3-ethyl-5-methyl-4-isoxazolyl)[4-(2-fluorophenyl)-1-piperazinyl], including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Methanone, (3-ethyl-5-methyl-4-isoxazolyl)[4-(2-fluorophenyl)-1-piperazinyl] |
|---|
| CAS Number | 932813-53-1 | Molecular Weight | 317.35800 |
|---|
| Density | 1.225g/cm3 | Boiling Point | 509.341ºC at 760 mmHg |
|---|
| Molecular Formula | C17H20FN3O2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 261.841ºC |
|---|
Names
| Name | Methanone, (3-ethyl-5-methyl-4-isoxazolyl)[4-(2-fluorophenyl)-1-piperazinyl] |
|---|
Chemical & Physical Properties
| Density | 1.225g/cm3 |
|---|
| Boiling Point | 509.341ºC at 760 mmHg |
|---|
| Molecular Formula | C17H20FN3O2 |
|---|
| Molecular Weight | 317.35800 |
|---|
| Flash Point | 261.841ºC |
|---|
| Exact Mass | 317.15400 |
|---|
| PSA | 49.58000 |
|---|
| LogP | 2.64980 |
|---|
| Index of Refraction | 1.565 |
|---|
| InChIKey | LISNIMTZSHGFEM-UHFFFAOYSA-N |
|---|
| SMILES | CCc1noc(C)c1C(=O)N1CCN(c2ccccc2F)CC1 |
|---|
