Introduction:Basic information about CAS 482306-17-2|2-Thiophenecarboxamide, 5-chloro-N-[3-[[3-cyano-4-(3-oxo-4-morpholinyl)phenyl]amino], including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-Thiophenecarboxamide, 5-chloro-N-[3-[[3-cyano-4-(3-oxo-4-morpholinyl)phenyl]amino]-2-hydroxypropyl] |
|---|
| CAS Number | 482306-17-2 | Molecular Weight | 434.89700 |
|---|
| Density | 1.49g/cm3 | Boiling Point | 821.6ºC at 760 mmHg |
|---|
| Molecular Formula | C19H19ClN4O4S | Melting Point | / |
|---|
| MSDS | / | Flash Point | 450.7ºC |
|---|
Names
| Name | 2-Thiophenecarboxamide, 5-chloro-N-[3-[[3-cyano-4-(3-oxo-4-morpholinyl)phenyl]amino]-2-hydroxypropyl] |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.49g/cm3 |
|---|
| Boiling Point | 821.6ºC at 760 mmHg |
|---|
| Molecular Formula | C19H19ClN4O4S |
|---|
| Molecular Weight | 434.89700 |
|---|
| Flash Point | 450.7ºC |
|---|
| Exact Mass | 434.08200 |
|---|
| PSA | 142.93000 |
|---|
| LogP | 2.36808 |
|---|
| Index of Refraction | 1.667 |
|---|
| InChIKey | YSUPIIJSHZYYHO-UHFFFAOYSA-N |
|---|
| SMILES | N#Cc1cc(NCC(O)CNC(=O)c2ccc(Cl)s2)ccc1N1CCOCC1=O |
|---|
Synonyms
| 5-Chloro-N-(2-methyl-3-trifluoromethylphenyl)-anthranilic acid |
| 5-Chloro-N-(3-{[3-cyano-4-(3-oxo-4-morpholinyl)phenyl]amino}-2-hydroxypropyl)-2-thiophenecarboxamide |
| Benzoic acid,5-chloro-2-[[2-methyl-3-(trifluoromethyl)phenyl]amino] |
| 5-Chloro-N-(3-{[3,5-dimethyl-4-(3-oxo-4-morpholinyl)phenyl]amino}-2-hydroxypropyl)-2-thiophenecarboxamide |