Introduction：Basic information about CAS 946496-56-6|Methanesulfonamide, N-[4-(1-aminocyclopropyl)-2-methoxyphenyl], including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Methanesulfonamide, N-[4-(1-aminocyclopropyl)-2-methoxyphenyl] |
|---|
| CAS Number | 946496-56-6 | Molecular Weight | 256.32100 |
|---|
| Density | 1.364g/cm3 | Boiling Point | 408ºC at 760 mmHg |
|---|
| Molecular Formula | C11H16N2O3S | Melting Point | / |
|---|
| MSDS | / | Flash Point | 200.5ºC |
|---|
Names
| Name | Methanesulfonamide, N-[4-(1-aminocyclopropyl)-2-methoxyphenyl] |
|---|
Chemical & Physical Properties
| Density | 1.364g/cm3 |
|---|
| Boiling Point | 408ºC at 760 mmHg |
|---|
| Molecular Formula | C11H16N2O3S |
|---|
| Molecular Weight | 256.32100 |
|---|
| Flash Point | 200.5ºC |
|---|
| Exact Mass | 256.08800 |
|---|
| PSA | 89.80000 |
|---|
| LogP | 2.86860 |
|---|
| Index of Refraction | 1.616 |
|---|
| InChIKey | FTCOJUCUCXVWJV-UHFFFAOYSA-N |
|---|
| SMILES | COc1cc(C2(N)CC2)ccc1NS(C)(=O)=O |
|---|
