Introduction：Basic information about CAS 503417-35-4|Benzoic acid, 3-(1-aminocyclopropyl)-, 1,1-dimethylethyl ester, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Benzoic acid, 3-(1-aminocyclopropyl)-, 1,1-dimethylethyl ester |
|---|
| CAS Number | 503417-35-4 | Molecular Weight | 233.30600 |
|---|
| Density | 1.106g/cm3 | Boiling Point | 340.3ºC at 760 mmHg |
|---|
| Molecular Formula | C14H19NO2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 187.7ºC |
|---|
Names
| Name | Benzoic acid, 3-(1-aminocyclopropyl)-, 1,1-dimethylethyl ester |
|---|
Chemical & Physical Properties
| Density | 1.106g/cm3 |
|---|
| Boiling Point | 340.3ºC at 760 mmHg |
|---|
| Molecular Formula | C14H19NO2 |
|---|
| Molecular Weight | 233.30600 |
|---|
| Flash Point | 187.7ºC |
|---|
| Exact Mass | 233.14200 |
|---|
| PSA | 52.32000 |
|---|
| LogP | 3.29000 |
|---|
| Index of Refraction | 1.551 |
|---|
| InChIKey | ZHYBSCVSARBULJ-UHFFFAOYSA-N |
|---|
| SMILES | CC(C)(C)OC(=O)c1cccc(C2(N)CC2)c1 |
|---|
