Introduction：Basic information about CAS 6223-83-2|9-Oxo-9H-fluorene-4-carboxylic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 9-Oxo-9H-fluorene-4-carboxylic acid |
|---|
| CAS Number | 6223-83-2 | Molecular Weight | 224.212 |
|---|
| Density | 1.4±0.1 g/cm3 | Boiling Point | 476.5±24.0 °C at 760 mmHg |
|---|
| Molecular Formula | C14H8O3 | Melting Point | 225-227 °C(lit.) |
|---|
| MSDS | ChineseUSA | Flash Point | 256.1±19.4 °C |
|---|
Names
| Name | 9-Fluorenone-4-carboxylic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.4±0.1 g/cm3 |
|---|
| Boiling Point | 476.5±24.0 °C at 760 mmHg |
|---|
| Melting Point | 225-227 °C(lit.) |
|---|
| Molecular Formula | C14H8O3 |
|---|
| Molecular Weight | 224.212 |
|---|
| Flash Point | 256.1±19.4 °C |
|---|
| Exact Mass | 224.047348 |
|---|
| PSA | 54.37000 |
|---|
| LogP | 3.26 |
|---|
| Vapour Pressure | 0.0±1.3 mmHg at 25°C |
|---|
| Index of Refraction | 1.701 |
|---|
| InChIKey | AFQYQSWTVCNJQT-UHFFFAOYSA-N |
|---|
| SMILES | O=C(O)c1cccc2c1-c1ccccc1C2=O |
|---|
Safety Information
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|
| Hazard Codes | Xi: Irritant; |
|---|
| Risk Phrases | R36/37/38 |
|---|
| Safety Phrases | S22-S24/25 |
|---|
| RIDADR | NONH for all modes of transport |
|---|
| WGK Germany | 3 |
|---|
| HS Code | 2918300090 |
|---|
Customs
| HS Code | 2918300090 |
|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
|---|
Synonyms
| 9-Oxo-9H-fluorene-4-carboxylic acid |
| 9H-Fluorene-4-carboxylic acid, 9-oxo- |
| EINECS 228-311-9 |
| MFCD00001145 |
| 9-oxofluorene-4-carboxylic acid |
