Introduction：Basic information about CAS 23707-33-7|metrifudil, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | metrifudil |
|---|
| CAS Number | 23707-33-7 | Molecular Weight | 371.39000 |
|---|
| Density | 1.57g/cm3 | Boiling Point | 694.1ºC at 760 mmHg |
|---|
| Molecular Formula | C18H21N5O4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 373.6ºC |
|---|
Names
Chemical & Physical Properties
| Density | 1.57g/cm3 |
|---|
| Boiling Point | 694.1ºC at 760 mmHg |
|---|
| Molecular Formula | C18H21N5O4 |
|---|
| Molecular Weight | 371.39000 |
|---|
| Flash Point | 373.6ºC |
|---|
| Exact Mass | 371.15900 |
|---|
| PSA | 125.55000 |
|---|
| LogP | 0.43130 |
|---|
| Vapour Pressure | 3.15E-20mmHg at 25°C |
|---|
| Index of Refraction | 1.743 |
|---|
| InChIKey | OOEMZCZWZXHBKW-SCFUHWHPSA-N |
|---|
| SMILES | Cc1ccccc1CNc1ncnc2c1ncn2C1OC(CO)C(O)C1O |
|---|
