Introduction：Basic information about CAS 62380-23-8|Cinecromen, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Cinecromen |
|---|
| CAS Number | 62380-23-8 | Molecular Weight | 651.70300 |
|---|
| Density | 1.284g/cm3 | Boiling Point | 866ºC at 760 mmHg |
|---|
| Molecular Formula | C34H41N3O10 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 477.5ºC |
|---|
Names
| Name | [1-[4-methyl-7-(morpholine-4-carbonylamino)-2-oxochromen-3-yl]-3-morpholin-4-ylpropan-2-yl] (E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.284g/cm3 |
|---|
| Boiling Point | 866ºC at 760 mmHg |
|---|
| Molecular Formula | C34H41N3O10 |
|---|
| Molecular Weight | 651.70300 |
|---|
| Flash Point | 477.5ºC |
|---|
| Exact Mass | 651.27900 |
|---|
| PSA | 138.24000 |
|---|
| LogP | 3.44000 |
|---|
| Index of Refraction | 1.597 |
|---|
| InChIKey | GWZZGHHMOLPYSZ-VMPITWQZSA-N |
|---|
| SMILES | COc1cc(C=CC(=O)OC(Cc2c(C)c3ccc(NC(=O)N4CCOCC4)cc3oc2=O)CN2CCOCC2)cc(OC)c1OC |
|---|
Synonyms
| Cinecromene |
| Cinecromen |
| Cinecromenum |
| Cinecromeno |
