Introduction：Basic information about CAS 103030-08-6|3-METHYL-6-NITROCOUMARIN, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 3-METHYL-6-NITROCOUMARIN |
|---|
| CAS Number | 103030-08-6 | Molecular Weight | 205.16700 |
|---|
| Density | 1.396g/cm3 | Boiling Point | 391.9ºC at 760mmHg |
|---|
| Molecular Formula | C10H7NO4 | Melting Point | 220-222ºC |
|---|
| MSDS | / | Flash Point | 199.6ºC |
|---|
Names
| Name | 3-methyl-6-nitrochromen-2-one |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.396g/cm3 |
|---|
| Boiling Point | 391.9ºC at 760mmHg |
|---|
| Melting Point | 220-222ºC |
|---|
| Molecular Formula | C10H7NO4 |
|---|
| Molecular Weight | 205.16700 |
|---|
| Flash Point | 199.6ºC |
|---|
| Exact Mass | 205.03800 |
|---|
| PSA | 76.03000 |
|---|
| LogP | 2.53280 |
|---|
| Vapour Pressure | 2.38E-06mmHg at 25°C |
|---|
| Index of Refraction | 1.611 |
|---|
| InChIKey | PWANMOIIIMORBV-UHFFFAOYSA-N |
|---|
| SMILES | Cc1cc2cc([N+](=O)[O-])ccc2oc1=O |
|---|
Safety Information
| Hazard Codes | Xi: Irritant; |
|---|
Synonyms
| 2-methyl-6-nitrochromone |
| 2-Methyl-6-nitro-chromen-4-on |
| 6-nitro-2-methyl chromone |
| 2-methyl-6nitro-4H-chromen-4-one |
| 3-Methyl-6-nitrocoumarin |
| 2-methyl-6-nitro-chromen-4-one |
| 4H-1-Benzopyran-4-one,2-methyl-6-nitro |
