Introduction：Basic information about CAS 87729-89-3|Seganserin, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Seganserin |
|---|
| CAS Number | 87729-89-3 | Molecular Weight | 471.54100 |
|---|
| Density | 1.22g/cm3 | Boiling Point | 615.5ºC at 760 mmHg |
|---|
| Molecular Formula | C29H27F2N3O | Melting Point | / |
|---|
| MSDS | / | Flash Point | 326.1ºC |
|---|
Names
| Name | Seganserin |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.22g/cm3 |
|---|
| Boiling Point | 615.5ºC at 760 mmHg |
|---|
| Molecular Formula | C29H27F2N3O |
|---|
| Molecular Weight | 471.54100 |
|---|
| Flash Point | 326.1ºC |
|---|
| Exact Mass | 471.21200 |
|---|
| PSA | 37.61000 |
|---|
| LogP | 5.35940 |
|---|
| Index of Refraction | 1.617 |
|---|
| InChIKey | ZGUPMFYFHHSNFK-UHFFFAOYSA-N |
|---|
| SMILES | Cc1nc2ccccn2c(=O)c1CCN1CCC(=C(c2ccc(F)cc2)c2ccc(F)cc2)CC1 |
|---|
Synonyms
| 3-[2-[4-[Bis(4-fluorophenyl)methylene]piperidino]ethyl]-2-methyl-4H-pyrido[1,2-a]pyrimidin-4-one |
