Introduction：Basic information about CAS 76953-65-6|Dramedilol, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Dramedilol |
|---|
| CAS Number | 76953-65-6 | Molecular Weight | 403.47500 |
|---|
| Density | 1.2g/cm3 | Boiling Point | 634.6ºC at 760 mmHg |
|---|
| Molecular Formula | C20H29N5O4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 337.6ºC |
|---|
Names
| Name | 1-[2-(3,4-dimethoxyphenyl)ethylamino]-3-[6-(2-propan-2-ylidenehydrazinyl)pyridazin-3-yl]oxypropan-2-ol |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.2g/cm3 |
|---|
| Boiling Point | 634.6ºC at 760 mmHg |
|---|
| Molecular Formula | C20H29N5O4 |
|---|
| Molecular Weight | 403.47500 |
|---|
| Flash Point | 337.6ºC |
|---|
| Exact Mass | 403.22200 |
|---|
| PSA | 113.35000 |
|---|
| LogP | 1.68630 |
|---|
| Index of Refraction | 1.566 |
|---|
| InChIKey | HLUGSJZJQJZYAE-UHFFFAOYSA-N |
|---|
| SMILES | COc1ccc(CCNCC(O)COc2ccc(NN=C(C)C)nn2)cc1OC |
|---|
Synonyms
| UNII-8PW276HX8U |
| Dramedilol |
| 1-{[2-(3,4-dimethoxyphenyl)ethyl]amino}-3-({6-[2-(propan-2-ylidene)hydrazinyl]pyridazin-3-yl}oxy)propan-2-ol |
| Dramedilol [INN] |
