Introduction：Basic information about CAS 23694-81-7|rac Mepindolol-d7, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | rac Mepindolol-d7 |
|---|
| CAS Number | 23694-81-7 | Molecular Weight | 262.34700 |
|---|
| Density | 1.131g/cm3 | Boiling Point | 469.9ºC at 760mmHg |
|---|
| Molecular Formula | C15H22N2O2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 238ºC |
|---|
Names
| Name | 1-[(2-methyl-1H-indol-4-yl)oxy]-3-(propan-2-ylamino)propan-2-ol |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.131g/cm3 |
|---|
| Boiling Point | 469.9ºC at 760mmHg |
|---|
| Molecular Formula | C15H22N2O2 |
|---|
| Molecular Weight | 262.34700 |
|---|
| Flash Point | 238ºC |
|---|
| Exact Mass | 262.16800 |
|---|
| PSA | 57.28000 |
|---|
| LogP | 2.60490 |
|---|
| Vapour Pressure | 1.24E-09mmHg at 25°C |
|---|
| Index of Refraction | 1.59 |
|---|
| InChIKey | NXWGWUVGUSFQJC-UHFFFAOYSA-N |
|---|
| SMILES | Cc1cc2c(OCC(O)CNC(C)C)cccc2[nH]1 |
|---|
Safety Information
Customs
| HS Code | 2933990090 |
|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|---|
Synonyms
| Mepindololum [INN-Latin] |
| Mepindolol |
| Mepindololum |
| 4-(3-isopropylamino-2-hydroxy-1-propyloxy)-2-methyl-indole |
| Racemic Mepindolol |
| EINECS 245-831-1 |
| 1-(Isopropylamino)-3-[(2-methylindol-4-yl)oxy]-2-propanol |
| 1-isopropylamino-3-(2-methyl-indol-4-yloxy)-propan-2-ol |
| ( inverted exclamation markA)-Mepindolol |
| rac Mepindolol |
