Introduction：Basic information about CAS 27031-08-9|sulfaguanole, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | sulfaguanole |
|---|
| CAS Number | 27031-08-9 | Molecular Weight | 309.34400 |
|---|
| Density | 1.53g/cm3 | Boiling Point | 556.7ºC at 760mmHg |
|---|
| Molecular Formula | C12H15N5O3S | Melting Point | / |
|---|
| MSDS | / | Flash Point | 290.5ºC |
|---|
Names
| Name | 2-(4-aminophenyl)sulfonyl-1-(4,5-dimethyl-1,3-oxazol-2-yl)guanidine |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.53g/cm3 |
|---|
| Boiling Point | 556.7ºC at 760mmHg |
|---|
| Molecular Formula | C12H15N5O3S |
|---|
| Molecular Weight | 309.34400 |
|---|
| Flash Point | 290.5ºC |
|---|
| Exact Mass | 309.09000 |
|---|
| PSA | 142.48000 |
|---|
| LogP | 3.42440 |
|---|
| Vapour Pressure | 0mmHg at 25°C |
|---|
| Index of Refraction | 1.684 |
|---|
| InChIKey | IJZUQDQOAFUFJY-UHFFFAOYSA-N |
|---|
| SMILES | Cc1nc(NC(N)=NS(=O)(=O)c2ccc(N)cc2)oc1C |
|---|
Safety Information
Customs
| HS Code | 2935009090 |
|---|
| Summary | 2935009090 other sulphonamides VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:35.0% |
|---|
Synonyms
| 1-(p-Aminophenylsulfonyl)-3-(4,5-dimethyl-2-oxazolyl)guanidin |
| Sulfaguanol |
| Sulfaguanole [INN] |
| EINECS 248-175-4 |
| Solfaguanolo [DCIT] |
| 4-amino-N-(4,5-dimethyl-oxazol-2-ylcarbamimidoyl)-benzenesulfonamide |
| Enterocura |
| Sulfaguanolum [INN-Latin] |
| N(sup 1)-((4,5-Dimethyl-2-oxazolyl)amidino)sulfanilamide |
| Sulfaguanole |
| sulphaguanol |
| Sulfaguanol [INN-Spanish] |
| N1-((4,5-Dimethyl-2-oxazolyl)amidino)sulfanilamid |
