Introduction：Basic information about CAS 72481-99-3|Brocrinat, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Brocrinat |
|---|
| CAS Number | 72481-99-3 | Molecular Weight | 366.13900 |
|---|
| Density | 1.661g/cm3 | Boiling Point | 533.2ºC at 760 mmHg |
|---|
| Molecular Formula | C15H9BrFNO4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 276.3ºC |
|---|
Names
| Name | 2-[[7-bromo-3-(2-fluorophenyl)-1,2-benzoxazol-6-yl]oxy]acetic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.661g/cm3 |
|---|
| Boiling Point | 533.2ºC at 760 mmHg |
|---|
| Molecular Formula | C15H9BrFNO4 |
|---|
| Molecular Weight | 366.13900 |
|---|
| Flash Point | 276.3ºC |
|---|
| Exact Mass | 364.97000 |
|---|
| PSA | 72.56000 |
|---|
| LogP | 3.85980 |
|---|
| Index of Refraction | 1.642 |
|---|
| InChIKey | QWOLGQYXAQSNAE-UHFFFAOYSA-N |
|---|
| SMILES | O=C(O)COc1ccc2c(-c3ccccc3F)noc2c1Br |
|---|
Synonyms
| Acide halocrinique |
| Acidum halocrinicum |
| Brocrinatum [Latin] |
| Brocrinate [French] |
| HP-522 |
| Brocrinate |
| Acido halocrinico |
| {[7-bromo-3-(2-fluorophenyl)-1,2-benzisoxazol-6-yl]oxy}acetic acid |
| BROCRINAT |
| Brocrinatum |
