Introduction：Basic information about CAS 56554-52-0|methyl perfluorododecanoate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | methyl perfluorododecanoate |
|---|
| CAS Number | 56554-52-0 | Molecular Weight | 628.12500 |
|---|
| Density | 1.66 | Boiling Point | 125°C 30mm |
|---|
| Molecular Formula | C13H3F23O2 | Melting Point | 54-56°C |
|---|
| MSDS | / | Flash Point | 87.4ºC |
|---|
Names
| Name | Methyl Tricosafluorododecanoate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.66 |
|---|
| Boiling Point | 125°C 30mm |
|---|
| Melting Point | 54-56°C |
|---|
| Molecular Formula | C13H3F23O2 |
|---|
| Molecular Weight | 628.12500 |
|---|
| Flash Point | 87.4ºC |
|---|
| Exact Mass | 627.97700 |
|---|
| PSA | 26.30000 |
|---|
| LogP | 7.07470 |
|---|
| Index of Refraction | 1.289 |
|---|
| InChIKey | ABNZIVVYHQYSLI-UHFFFAOYSA-N |
|---|
| SMILES | COC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
|---|
Safety Information
| Hazard Codes | F |
|---|
| Safety Phrases | S24/25 |
|---|
Synonyms
| methyl 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,12-tricosafluorododecanoate |
| MFCD00236616 |
