Introduction：Basic information about CAS 23453-64-7|perfluoroazelaic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | perfluoroazelaic acid |
|---|
| CAS Number | 23453-64-7 | Molecular Weight | 440.08700 |
|---|
| Density | 1.811g/cm3 | Boiling Point | 215°C 60mm |
|---|
| Molecular Formula | C9H2F14O4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 215°C/60mm |
|---|
Names
| Name | 2,2,3,3,4,4,5,5,6,6,7,7,8,8-tetradecafluorononanedioic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.811g/cm3 |
|---|
| Boiling Point | 215°C 60mm |
|---|
| Molecular Formula | C9H2F14O4 |
|---|
| Molecular Weight | 440.08700 |
|---|
| Flash Point | 215°C/60mm |
|---|
| Exact Mass | 439.97300 |
|---|
| PSA | 74.60000 |
|---|
| LogP | 3.60270 |
|---|
| Vapour Pressure | 0.000277mmHg at 25°C |
|---|
| Index of Refraction | 1.325 |
|---|
| InChIKey | WRYSWXOLGMKBKW-UHFFFAOYSA-N |
|---|
| SMILES | O=C(O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(=O)O |
|---|
Safety Information
| Hazard Codes | C: Corrosive; |
|---|
| Risk Phrases | R34 |
|---|
| Safety Phrases | S26-S36/37/39-S45 |
|---|
| RIDADR | 3261 |
|---|
| Packaging Group | II |
|---|
| Hazard Class | 8 |
|---|
| HS Code | 2917190090 |
|---|
Customs
| HS Code | 2917190090 |
|---|
| Summary | 2917190090 acyclic polycarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|---|
Synonyms
| perfluorononanedioic acid |
| Tetradecafluoroazelaic acid |
| Perfluorononane-1,9-dioic acid,tech |
| perfluoroazelaic acid |
| MFCD00153274 |
| Perfluorheptan-1.7-dicarbonsaeure |
| perfluorononane-1,9-dioic acid |
