Introduction：Basic information about CAS 76-17-5|1,2,3-trichloropentafluoropropane, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1,2,3-trichloropentafluoropropane |
|---|
| CAS Number | 76-17-5 | Molecular Weight | 237.38300 |
|---|
| Density | 1.663 | Boiling Point | 74ºC |
|---|
| Molecular Formula | C3Cl3F5 | Melting Point | -72°C |
|---|
| MSDS | / | Flash Point | 4.6ºC |
|---|
Names
| Name | 1,2,3-trichloro-1,1,2,3,3-pentafluoropropane |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.663 |
|---|
| Boiling Point | 74ºC |
|---|
| Melting Point | -72°C |
|---|
| Molecular Formula | C3Cl3F5 |
|---|
| Molecular Weight | 237.38300 |
|---|
| Flash Point | 4.6ºC |
|---|
| Exact Mass | 235.89900 |
|---|
| LogP | 3.55420 |
|---|
| Index of Refraction | 1.351 |
|---|
| InChIKey | AIDLQDHQDQZVQM-UHFFFAOYSA-N |
|---|
| SMILES | FC(F)(Cl)C(F)(Cl)C(F)(F)Cl |
|---|
Safety Information
Synonyms
| 1,2,3-Trichlor-pentafluor-propan |
| Propane,1,2,3-trichloro-1,1,2,3,3-pentafluoro |
| 1,2,3-trichloro-1,1,2,3,3-pentafluoro-propane |
| 1,2,3-trichloro-pentafluoro-propane |
| 1,2,3-trichloropentafluropropane |
| 1,2,3-trichloropentaluoropropane |
| Propane,1,2,3-trichloropentafluoro |
