CAS 81907-61-1|Ganoderic acid B
Introduction：Basic information about CAS 81907-61-1|Ganoderic acid B, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Ganoderic acid B | ||
|---|---|---|---|
| CAS Number | 81907-61-1 | Molecular Weight | 516.666 |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 689.0±55.0 °C at 760 mmHg |
| Molecular Formula | C30H44O7 | Melting Point | / |
| MSDS | Chinese | Flash Point | 384.4±28.0 °C |
Names
| Name | (2R,6R)-6-[(3S,5R,7S,10S,13R,14R,17R)-3,7-dihydroxy-4,4,10,13,14-pentamethyl-11,15-dioxo-2,3,5,6,7,12,16,17-octahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-methyl-4-oxoheptanoic acid |
|---|---|
| Synonym | More Synonyms |
Ganoderic acid B BiologicalActivity
| Description | Ganoderic acid B is a triterpene isolated from a mushroom Ganoderma lucidum. Ganoderic acid B inhibits the activation of Epstein-Barr virus (EBV) antigens as telomerase inhibitor. Ganoderic acid B is a moderately active inhibitor against HIV-1 protease[1][2][3]. |
|---|---|
| Related Catalog | Research Areas >>InfectionSignaling Pathways >>Metabolic Enzyme/Protease >>HIV Protease |
| Target | HIV-1 protease[3] |
| References | [1]. Zhou S, et al. Triterpenes and Soluble Polysaccharide Changes in Lingzhi or Reishi Medicinal Mushroom, Ganoderma lucidum (Agaricomycetes), During Fruiting Growth. Int J Med Mushrooms. 2018;20(9):859-871. [2]. Zheng DS, et al. Triterpenoids from Ganoderma lucidum inhibit the activation of EBV antigens as telomerase inhibitors. Exp Ther Med. 2017 Oct;14(4):3273-3278. [3]. el-Mekkawy S, et al. Anti-HIV-1 and anti-HIV-1-protease substances from Ganoderma lucidum. Phytochemistry. 1998 Nov;49(6):1651-7. |
Chemical & Physical Properties
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 689.0±55.0 °C at 760 mmHg |
| Molecular Formula | C30H44O7 |
| Molecular Weight | 516.666 |
| Flash Point | 384.4±28.0 °C |
| Exact Mass | 516.308716 |
| PSA | 128.97000 |
| LogP | 2.33 |
| Vapour Pressure | 0.0±4.9 mmHg at 25°C |
| Index of Refraction | 1.565 |
| InChIKey | LWPLEHFGBRFRKI-NBCWKOIPSA-N |
| SMILES | CC(CC(=O)CC(C)C1CC(=O)C2(C)C3=C(C(=O)CC12C)C1(C)CCC(O)C(C)(C)C1CC3O)C(=O)O |
| Storage condition | -20C |
Synonyms
| Ganoderic acid β |
| Ganoderic acid A |
| (7|A,15|A,25r)-7,15-dihydroxy-3,11,23-trioxolanost-8-en-26-oic acid |
| (3β,7β,25R)-3,7-Dihydroxy-11,15,23-trioxolanost-8-en-26-oic acid |
| ganoderic acid B |
| Lanost-8-en-26-oic acid, 3,7-dihydroxy-11,15,23-trioxo-, (3β,7β)- |
| Ganoderic acid |
| Lanost-8-en-26-oic acid, 3,7-dihydroxy-11,15,23-trioxo-, (3β,7β,25R)- |
| (3β,7β)-3,7-Dihydroxy-11,15,23-trioxolanost-8-en-26-oic acid |
| 24,25-Dihydrolanosterol |
