Introduction：Basic information about CAS 66753-06-8|4-Amino-2-hydroxy-6-tert-butylamino-1,3,5-triazine, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-Amino-2-hydroxy-6-tert-butylamino-1,3,5-triazine |
|---|
| CAS Number | 66753-06-8 | Molecular Weight | 183.21100 |
|---|
| Density | 1.38g/cm3 | Boiling Point | 281.6ºC at 760 mmHg |
|---|
| Molecular Formula | C7H13N5O | Melting Point | / |
|---|
| MSDS | / | Flash Point | 124.1ºC |
|---|
Names
| Name | 2-amino-6-(tert-butylamino)-1H-1,3,5-triazin-4-one |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.38g/cm3 |
|---|
| Boiling Point | 281.6ºC at 760 mmHg |
|---|
| Molecular Formula | C7H13N5O |
|---|
| Molecular Weight | 183.21100 |
|---|
| Flash Point | 124.1ºC |
|---|
| Exact Mass | 183.11200 |
|---|
| PSA | 96.95000 |
|---|
| LogP | 1.02400 |
|---|
| Index of Refraction | 1.631 |
|---|
| InChIKey | NUISVCFZNCYUIM-UHFFFAOYSA-N |
|---|
| SMILES | CC(C)(C)Nc1nc(N)[nH]c(=O)n1 |
|---|
Synonyms
| 1,3,5-Triazin-2(1H)-one,4-amino-6-((1,1-dimethylethyl)amino) |
| 4-Amino-2-hydroxy-6-tert-butylamino-1,3,5-triazine |
| DEHT |
