Introduction：Basic information about CAS 690632-04-3|2-(2,3-dihydro-1-benzofuran-5-yl)-4-methyl-1,3-thiazole-5-carboxylic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-(2,3-dihydro-1-benzofuran-5-yl)-4-methyl-1,3-thiazole-5-carboxylic acid |
|---|
| CAS Number | 690632-04-3 | Molecular Weight | 261.29600 |
|---|
| Density | 1.402g/cm3 | Boiling Point | 492ºC at 760 mmHg |
|---|
| Molecular Formula | C13H11NO3S | Melting Point | 221ºC |
|---|
| MSDS | USA | Flash Point | 251.4ºC |
|---|
Names
| Name | 2-(2,3-dihydro-1-benzofuran-5-yl)-4-methyl-1,3-thiazole-5-carboxylic acid |
|---|
Chemical & Physical Properties
| Density | 1.402g/cm3 |
|---|
| Boiling Point | 492ºC at 760 mmHg |
|---|
| Melting Point | 221ºC |
|---|
| Molecular Formula | C13H11NO3S |
|---|
| Molecular Weight | 261.29600 |
|---|
| Flash Point | 251.4ºC |
|---|
| Exact Mass | 261.04600 |
|---|
| PSA | 87.66000 |
|---|
| LogP | 2.75160 |
|---|
| Index of Refraction | 1.653 |
|---|
| InChIKey | DCXMMNGTUXDRND-UHFFFAOYSA-N |
|---|
| SMILES | Cc1nc(-c2ccc3c(c2)CCO3)sc1C(=O)O |
|---|
