Introduction:Basic information about CAS 1095-78-9|2,2-Bis(4-aminophenyl)hexafluoropropane, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2,2-Bis(4-aminophenyl)hexafluoropropane |
|---|
| CAS Number | 1095-78-9 | Molecular Weight | 334.260 |
|---|
| Density | 1.4±0.1 g/cm3 | Boiling Point | 351.2±42.0 °C at 760 mmHg |
|---|
| Molecular Formula | C15H12F6N2 | Melting Point | 195-198 °C(lit.) |
|---|
| MSDS | ChineseUSA | Flash Point | 159.4±18.6 °C |
|---|
| Symbol | GHS07 | Signal Word | Warning |
|---|
Names
| Name | 2,2-Bis(4-aminophenyl)hexafluoropropane |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.4±0.1 g/cm3 |
|---|
| Boiling Point | 351.2±42.0 °C at 760 mmHg |
|---|
| Melting Point | 195-198 °C(lit.) |
|---|
| Molecular Formula | C15H12F6N2 |
|---|
| Molecular Weight | 334.260 |
|---|
| Flash Point | 159.4±18.6 °C |
|---|
| Exact Mass | 334.090454 |
|---|
| PSA | 52.04000 |
|---|
| LogP | 1.73 |
|---|
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
|---|
| Index of Refraction | 1.527 |
|---|
| InChIKey | BEKFRNOZJSYWKZ-UHFFFAOYSA-N |
|---|
| SMILES | Nc1ccc(C(c2ccc(N)cc2)(C(F)(F)F)C(F)(F)F)cc1 |
|---|
| Water Solubility | insoluble |
|---|
Safety Information
| Symbol | GHS07 |
|---|
| Signal Word | Warning |
|---|
| Hazard Statements | H315-H319-H335 |
|---|
| Precautionary Statements | P261-P305 + P351 + P338 |
|---|
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
|---|
| Hazard Codes | Xi: Irritant; |
|---|
| Risk Phrases | R36/37/38 |
|---|
| Safety Phrases | S26-S37/39 |
|---|
| RIDADR | NONH for all modes of transport |
|---|
| WGK Germany | 3 |
|---|
| HS Code | 2921590090 |
|---|
Customs
| HS Code | 2921590090 |
|---|
| Summary | 2921590090. other aromatic polyamines and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|---|
Synonyms
| 2,2-Bis(4-aMinophenyl)hexafluoropropane |
| 4,4′-(hexafluoroisopropylidene) dianiline |
| Benzenamine, 4,4'-[2,2,2-trifluoro-1-(trifluoromethyl)ethylidene]bis- |
| MFCD00039146 |
| 4,4'-(2,2,2-Trifluoro-1-(trifluoromethyl)ethylidene)bisbenzeneamine |
| 4,4‘-(Hexafluoroisopropylidene)dianiline |
| 4-[1-(4-aminophenyl)-2,2,2-trifluoro-1-(trifluoromethyl)ethyl]phenylamine |
| 4,4'-(1,1,1,3,3,3-Hexafluoropropane-2,2-diyl)dianiline |
| 4,4′-(Hexafluoroisopropylidene)dianiline |
| 4-[2-(4-aminophenyl)-1,1,1,3,3,3-hexafluoropropan-2-yl]aniline |
| 4,4'-(1,1,1,3,3,3-Hexafluoro-2,2-propanediyl)dianiline |
| Benzenamine, 4,4'-(2,2,2-trifluoro-1-(trifluoromethyl)ethylidene)bis- |
| 4,4'-(Hexafluoroisopropylidene)dianiline |