Introduction:Basic information about CAS 6936-95-4|4-methyl-2,6-dioxo-4-phenyl-piperidine-3,5-dicarbonitrile, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-methyl-2,6-dioxo-4-phenyl-piperidine-3,5-dicarbonitrile |
|---|
| CAS Number | 6936-95-4 | Molecular Weight | 253.25600 |
|---|
| Density | 1.3g/cm3 | Boiling Point | 566.5ºC at 760 mmHg |
|---|
| Molecular Formula | C14H11N3O2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 296.4ºC |
|---|
Names
| Name | 4-methyl-2,6-dioxo-4-phenylpiperidine-3,5-dicarbonitrile |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.3g/cm3 |
|---|
| Boiling Point | 566.5ºC at 760 mmHg |
|---|
| Molecular Formula | C14H11N3O2 |
|---|
| Molecular Weight | 253.25600 |
|---|
| Flash Point | 296.4ºC |
|---|
| Exact Mass | 253.08500 |
|---|
| PSA | 93.75000 |
|---|
| LogP | 1.20906 |
|---|
| Index of Refraction | 1.591 |
|---|
| InChIKey | DUHIKGWFSCWEBA-UHFFFAOYSA-N |
|---|
| SMILES | CC1(c2ccccc2)C(C#N)C(=O)NC(=O)C1C#N |
|---|
Safety Information
Customs
| HS Code | 2926909090 |
|---|
| Summary | HS:2926909090 other nitrile-function compounds VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|---|
Synonyms
| 4-methyl-2,6-dioxo-4-phenyl-piperidine-3,5-dicarbonitrile |
| 4-methyl-4-phenyl-3,5-dicyano-2,6-piperidinedione |
| 2,4-dicyano-3-methyl-3-phenylglutarimide |
| 1,3-Benzenedicarbonitrile,4-amino-2,5,6-trifluoro |
| 4-amino-2,5,6-trifluoroisophthalonitrile |
| 2,4-dicyano-3,5,6-trifluoroaniline |
| 3-Methyl-3-phenyl-2,4-dicyan-glutarimid |
| 4-Methyl-2,6-dioxo-4-phenyl-piperidin-3,5-dicarbonitril |