Introduction:Basic information about CAS 6290-86-4|N-ethyl-4-(4-ethylaminophenyl)aniline, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | N-ethyl-4-(4-ethylaminophenyl)aniline |
|---|
| CAS Number | 6290-86-4 | Molecular Weight | 240.34300 |
|---|
| Density | 1.06g/cm3 | Boiling Point | 407.9ºC at 760 mmHg |
|---|
| Molecular Formula | C16H20N2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 252.9ºC |
|---|
Names
| Name | N-ethyl-4-[4-(ethylamino)phenyl]aniline |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.06g/cm3 |
|---|
| Boiling Point | 407.9ºC at 760 mmHg |
|---|
| Molecular Formula | C16H20N2 |
|---|
| Molecular Weight | 240.34300 |
|---|
| Flash Point | 252.9ºC |
|---|
| Exact Mass | 240.16300 |
|---|
| PSA | 24.06000 |
|---|
| LogP | 4.36320 |
|---|
| Index of Refraction | 1.617 |
|---|
| InChIKey | FSSYNTJUYWSXFS-UHFFFAOYSA-N |
|---|
| SMILES | CCNc1ccc(-c2ccc(NCC)cc2)cc1 |
|---|
Synonyms
| N,N'-diethyl-(1,1'-biphenyl)-4,4'-diamine |
| N,N'-Diethylbenzidin |
| N,N'-diethylbenzidine |
| N,N'-Diaethyl-benzidin |
| Diethyl-N,N'-benzidin |
| n,n'-diethylbiphenyl-4,4'-diamine |