Introduction：Basic information about CAS 6952-67-6|2-(3-Nitrophenyl)-1,3-dioxolane, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-(3-Nitrophenyl)-1,3-dioxolane |
|---|
| CAS Number | 6952-67-6 | Molecular Weight | 195.172 |
|---|
| Density | 1.3±0.1 g/cm3 | Boiling Point | 310.4±37.0 °C at 760 mmHg |
|---|
| Molecular Formula | C9H9NO4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 149.4±28.5 °C |
|---|
Names
| Name | 2-(3-nitrophenyl)-1,3-dioxolane |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.3±0.1 g/cm3 |
|---|
| Boiling Point | 310.4±37.0 °C at 760 mmHg |
|---|
| Molecular Formula | C9H9NO4 |
|---|
| Molecular Weight | 195.172 |
|---|
| Flash Point | 149.4±28.5 °C |
|---|
| Exact Mass | 195.053162 |
|---|
| PSA | 64.28000 |
|---|
| LogP | 1.36 |
|---|
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
|---|
| Index of Refraction | 1.568 |
|---|
| InChIKey | YOGPCAYIEHLIMG-UHFFFAOYSA-N |
|---|
| SMILES | O=[N+]([O-])c1cccc(C2OCCO2)c1 |
|---|
Safety Information
Synonyms
| 3-nitrophenyl-1,3-dioxolane |
| 3-Nitrobenzaldehyde ethylene acetal |
| 2-(3-Nitro-phenyl)-[1,3]dioxolane |
| 3-nitrobenzyl ethylene acetal |
| 2-(3-Nitrophenyl)-1,3-dioxolane |
| 1,3-Dioxolane, 2-(3-nitrophenyl)- |
| 1,3-Dioxolane, 2- (3-nitrophenyl)- |
| 1,3-Dioxolane, 2- (m-nitrophenyl)- |
