Introduction：Basic information about CAS 7255-89-2|1-benzyl-N-(2-nitrophenyl)piperidin-4-amine, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1-benzyl-N-(2-nitrophenyl)piperidin-4-amine |
|---|
| CAS Number | 7255-89-2 | Molecular Weight | 311.37800 |
|---|
| Density | 1.232g/cm3 | Boiling Point | 466.8ºC at 760 mmHg |
|---|
| Molecular Formula | C18H21N3O2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 236.1ºC |
|---|
Names
| Name | 1-benzyl-N-(2-nitrophenyl)piperidin-4-amine |
|---|
Chemical & Physical Properties
| Density | 1.232g/cm3 |
|---|
| Boiling Point | 466.8ºC at 760 mmHg |
|---|
| Molecular Formula | C18H21N3O2 |
|---|
| Molecular Weight | 311.37800 |
|---|
| Flash Point | 236.1ºC |
|---|
| Exact Mass | 311.16300 |
|---|
| PSA | 61.09000 |
|---|
| LogP | 4.20540 |
|---|
| Index of Refraction | 1.644 |
|---|
| InChIKey | YZKQBUWNKRTZQC-UHFFFAOYSA-N |
|---|
| SMILES | O=[N+]([O-])c1ccccc1NC1CCN(Cc2ccccc2)CC1 |
|---|
