Introduction：Basic information about CAS 6686-26-6|Benzenebutanoicacid, 4-(phenylmethoxy)-, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Benzenebutanoicacid, 4-(phenylmethoxy)- |
|---|
| CAS Number | 6686-26-6 | Molecular Weight | 270.32300 |
|---|
| Density | 1.152g/cm3 | Boiling Point | 442.8ºC at 760mmHg |
|---|
| Molecular Formula | C17H18O3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 161.8ºC |
|---|
Names
| Name | 4-(4-phenylmethoxyphenyl)butanoic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.152g/cm3 |
|---|
| Boiling Point | 442.8ºC at 760mmHg |
|---|
| Molecular Formula | C17H18O3 |
|---|
| Molecular Weight | 270.32300 |
|---|
| Flash Point | 161.8ºC |
|---|
| Exact Mass | 270.12600 |
|---|
| PSA | 46.53000 |
|---|
| LogP | 3.67290 |
|---|
| Index of Refraction | 1.577 |
|---|
| InChIKey | RKDXPVYOANKPNA-UHFFFAOYSA-N |
|---|
| SMILES | O=C(O)CCCc1ccc(OCc2ccccc2)cc1 |
|---|
Synonyms
| 4-[4-(benzyloxy)phenyl]butanoic acid |
| 4-(4-benzyloxyphenyl)butyric acid |
| 4-[4-(Benzyloxy)-phenyl]-buttersaeure |
