Introduction：Basic information about CAS 28565-98-2|2-[(2-phenylacetyl)amino]benzoic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-[(2-phenylacetyl)amino]benzoic acid |
|---|
| CAS Number | 28565-98-2 | Molecular Weight | 255.26900 |
|---|
| Density | 1.304g/cm3 | Boiling Point | 517.7ºC at 760 mmHg |
|---|
| Molecular Formula | C15H13NO3 | Melting Point | / |
|---|
| MSDS | ChineseUSA | Flash Point | 266.9ºC |
|---|
Names
| Name | 2-[(2-phenylacetyl)amino]benzoic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.304g/cm3 |
|---|
| Boiling Point | 517.7ºC at 760 mmHg |
|---|
| Molecular Formula | C15H13NO3 |
|---|
| Molecular Weight | 255.26900 |
|---|
| Flash Point | 266.9ºC |
|---|
| Exact Mass | 255.09000 |
|---|
| PSA | 66.40000 |
|---|
| LogP | 2.63900 |
|---|
| Vapour Pressure | 1.52E-11mmHg at 25°C |
|---|
| Index of Refraction | 1.656 |
|---|
| InChIKey | WLWHMIHDEXBKCR-UHFFFAOYSA-N |
|---|
| SMILES | O=C(Cc1ccccc1)Nc1ccccc1C(=O)O |
|---|
Safety Information
Customs
| HS Code | 2924299090 |
|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|---|
Synonyms
| 2-(2-phenylacetamido)benzoic Acid |
| benzoic acid,2-[(2-phenylacetyl)amino] |
| N-phenacetylanthranilic acid |
| o-(phenylacetyl)aminobenzoic acid |
| 2-(phenylacetamido)-benzoic acid |
| N-phenylacetyl-anthranilic acid |
| 2-<(Phenylacetyl)amino>benzoic acid |
