Introduction:Basic information about CAS 175204-32-7|2,6-dibromo-4-chloro-3,5-dimethylphenol, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2,6-dibromo-4-chloro-3,5-dimethylphenol |
|---|
| CAS Number | 175204-32-7 | Molecular Weight | 314.40200 |
|---|
| Density | 1.908g/cm3 | Boiling Point | 291.2ºC at 760mmHg |
|---|
| Molecular Formula | C8H7Br2ClO | Melting Point | 158-160ºC |
|---|
| MSDS | / | Flash Point | 129.9ºC |
|---|
Names
| Name | 2,6-dibromo-4-chloro-3,5-dimethylphenol |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.908g/cm3 |
|---|
| Boiling Point | 291.2ºC at 760mmHg |
|---|
| Melting Point | 158-160ºC |
|---|
| Molecular Formula | C8H7Br2ClO |
|---|
| Molecular Weight | 314.40200 |
|---|
| Flash Point | 129.9ºC |
|---|
| Exact Mass | 311.85500 |
|---|
| PSA | 20.23000 |
|---|
| LogP | 4.18740 |
|---|
| Vapour Pressure | 0.00113mmHg at 25°C |
|---|
| Index of Refraction | 1.622 |
|---|
| InChIKey | JVJYURWOPAQMPX-UHFFFAOYSA-N |
|---|
| SMILES | Cc1c(Cl)c(C)c(Br)c(O)c1Br |
|---|
Safety Information
Customs
| HS Code | 2908199090 |
|---|
| Summary | HS: 2908199090. derivatives of polyphenols or phenol-alcohols containing only halogen substituents and their salts. VAT:17.0%. tax rebate rate:9.0%. supervision conditions:None. MFN tariff:5.5%. general tariff:30.0% |
|---|
Synonyms
| 4-CHLORO-2,6-DIBROMO-3,5-DIMETHYLPHENOL |
| 2-Chlor-4.6-dibrom-5-hydroxy-m-xylol |
| 4-Chlor-2.6-dibrom-symm.-m-xylenol |
| 2,6-dibromo-4-chloro-3,5-dimethyl-phenol |
| 2,6-Dibrom-4-chlor-3,5-dimethyl-phenol |