Introduction:Basic information about CAS 176039-39-7|(R-2-AMINO-1,1-DIFLUORO2-PHENYL)ETHYLPHOSPHONICACID, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | (R-2-AMINO-1,1-DIFLUORO2-PHENYL)ETHYLPHOSPHONICACID |
|---|
| CAS Number | 176039-39-7 | Molecular Weight | 412.43600 |
|---|
| Density | 1.284g/cm3 | Boiling Point | 634.6ºC at 760 mmHg |
|---|
| Molecular Formula | C22H24N2O6 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 337.6ºC |
|---|
| Symbol | GHS05, GHS06, GHS08 | Signal Word | Danger |
|---|
Names
| Name | 2-(9H-fluoren-9-ylmethoxycarbonylamino)-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.284g/cm3 |
|---|
| Boiling Point | 634.6ºC at 760 mmHg |
|---|
| Molecular Formula | C22H24N2O6 |
|---|
| Molecular Weight | 412.43600 |
|---|
| Flash Point | 337.6ºC |
|---|
| Exact Mass | 412.16300 |
|---|
| PSA | 113.96000 |
|---|
| LogP | 4.24230 |
|---|
| Vapour Pressure | 5.61E-17mmHg at 25°C |
|---|
| Index of Refraction | 1.586 |
|---|
| InChIKey | AWCFKRJSLGKRNA-UHFFFAOYSA-N |
|---|
| SMILES | CC(C)(C)OC(=O)NC(NC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)O |
|---|
Safety Information
| Symbol | GHS05, GHS06, GHS08 |
|---|
| Signal Word | Danger |
|---|
| Hazard Statements | H301 + H311 + H331-H314-H317-H335-H341-H350-H370 |
|---|
| Precautionary Statements | P201-P260-P280-P301 + P310 + P330-P303 + P361 + P353-P304 + P340 + P310-P305 + P351 + P338-P308 + P311 |
|---|
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|
| RIDADR | UN 2209 8 / PGIII |
|---|
| WGK Germany | 3 |
|---|
| HS Code | 2924299090 |
|---|
Customs
| HS Code | 2924299090 |
|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|---|
Synonyms
| N-Boc-N inverted exclamation marka-Fmoc-diaminoacetic acid |
| N-Boc-N'-Fmoc-diaminoacetic acid |
| t-butoxycarbonylamino-9-fluorenylmethyloxycarbonylamino-acetic acid |