Introduction：Basic information about CAS 17632-18-7|2 3 7 8 12 13 17 18-OCTAETHYL-21H 23H-, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2 3 7 8 12 13 17 18-OCTAETHYL-21H 23H- |
|---|
| CAS Number | 17632-18-7 | Molecular Weight | 598.14100 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C36H44N4Zn | Melting Point | / |
|---|
| MSDS | USA | Flash Point | / |
|---|
Names
| Name | zinc octaethylporphyrin |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Molecular Formula | C36H44N4Zn |
|---|
| Molecular Weight | 598.14100 |
|---|
| Exact Mass | 596.28600 |
|---|
| PSA | 34.58000 |
|---|
| LogP | 6.13170 |
|---|
| InChIKey | VVUVWOLOUOYXOI-UHFFFAOYSA-N |
|---|
| SMILES | CCC1=C(CC)c2cc3[n-]c(cc4[n-]c(cc5nc(cc1n2)C(CC)=C5CC)c(CC)c4CC)c(CC)c3CC.[Zn+2] |
|---|
Safety Information
| RIDADR | NONH for all modes of transport |
|---|
Synonyms
| Octaethylene glycol monotetradecyl ether |
| zinc-2,3,7,8,12,13,17,18-octaethyl-21H,23H-porphyrin |
| Polyoxyethylene 8 myristyl ether |
| 3,6,9,12,15,18,21,24-Octaoxaoctatriacontan-1-ol |
| MFCD00012156 |
| Tetradecyl octaethylene glycol ether |
| 2,3,7,8,12,13,17,18-octaethyl-21H,23H-porphine zinc |
| (2,3,7,8,12,13,17,18-octaethylporphyrinato)zinc(II) |
| Tetradecyloctaglycol |
| C14E8 |
