Introduction：Basic information about CAS 541505-14-0|4-chloro-7-methoxy-5-[(1-methyl-4-piperidyl)oxy]quinoline-3-carbo nitrile, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-chloro-7-methoxy-5-[(1-methyl-4-piperidyl)oxy]quinoline-3-carbo nitrile |
|---|
| CAS Number | 541505-14-0 | Molecular Weight | 331.79700 |
|---|
| Density | 1.31g/cm3 | Boiling Point | 499.3ºC at 760 mmHg |
|---|
| Molecular Formula | C17H18ClN3O2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 255.8ºC |
|---|
Names
| Name | 4-chloro-7-methoxy-5-[(1-methyl-4-piperidyl)oxy]quinoline-3-carbo nitrile |
|---|
Chemical & Physical Properties
| Density | 1.31g/cm3 |
|---|
| Boiling Point | 499.3ºC at 760 mmHg |
|---|
| Molecular Formula | C17H18ClN3O2 |
|---|
| Molecular Weight | 331.79700 |
|---|
| Flash Point | 255.8ºC |
|---|
| Exact Mass | 331.10900 |
|---|
| PSA | 58.38000 |
|---|
| LogP | 3.17938 |
|---|
| Index of Refraction | 1.625 |
|---|
| InChIKey | VLJSBQSZEAUVQB-UHFFFAOYSA-N |
|---|
| SMILES | COc1cc(OC2CCN(C)CC2)c2c(Cl)c(C#N)cnc2c1 |
|---|
