Introduction:Basic information about CAS 915369-22-1|8-Bromo-4-chloro-6-nitro-3-quinolinecarbonitrile, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 8-Bromo-4-chloro-6-nitro-3-quinolinecarbonitrile |
|---|
| CAS Number | 915369-22-1 | Molecular Weight | 312.50700 |
|---|
| Density | 1.91g/cm3 | Boiling Point | 476ºC at 760 mmHg |
|---|
| Molecular Formula | C10H3BrClN3O2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 241.7ºC |
|---|
Names
| Name | 8-Bromo-4-chloro-6-nitro-3-quinolinecarbonitrile |
|---|
Chemical & Physical Properties
| Density | 1.91g/cm3 |
|---|
| Boiling Point | 476ºC at 760 mmHg |
|---|
| Molecular Formula | C10H3BrClN3O2 |
|---|
| Molecular Weight | 312.50700 |
|---|
| Flash Point | 241.7ºC |
|---|
| Exact Mass | 310.91000 |
|---|
| PSA | 82.50000 |
|---|
| LogP | 3.95378 |
|---|
| Index of Refraction | 1.732 |
|---|
| InChIKey | YNOFDLZGNVSUFM-UHFFFAOYSA-N |
|---|
| SMILES | N#Cc1cnc2c(Br)cc([N+](=O)[O-])cc2c1Cl |
|---|