Introduction：Basic information about CAS 937-13-3|Oxonic Acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Oxonic Acid |
|---|
| CAS Number | 937-13-3 | Molecular Weight | 157.08400 |
|---|
| Density | 2.19g/cm3 | Boiling Point | 771.4ºC at 760mmHg |
|---|
| Molecular Formula | C4H3N3O4 | Melting Point | 261-261ºC |
|---|
| MSDS | / | Flash Point | 420.4ºC |
|---|
Names
| Name | 5-azaorotic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 2.19g/cm3 |
|---|
| Boiling Point | 771.4ºC at 760mmHg |
|---|
| Melting Point | 261-261ºC |
|---|
| Molecular Formula | C4H3N3O4 |
|---|
| Molecular Weight | 157.08400 |
|---|
| Flash Point | 420.4ºC |
|---|
| Exact Mass | 157.01200 |
|---|
| PSA | 116.17000 |
|---|
| InChIKey | RYYCJUAHISIHTL-UHFFFAOYSA-N |
|---|
| SMILES | O=C(O)c1nc(=O)[nH]c(=O)[nH]1 |
|---|
Safety Information
Customs
| HS Code | 2933699090 |
|---|
| Summary | 2933699090 other compounds containing an unfused triazine ring (whether or not hydrogenated) in the structure。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:20.0% |
|---|
Synonyms
| OXC |
| Potassium azaorotate |
| 5-Aza-orotsaeure |
| 4,6-dioxo-1H-1,3,5-triazine-2-carboxylic acid |
| Sodium 5-azaorotate |
| Oxonate |
| Oteracil |
| Oxonic Acid |
| 4,6-dioxo-1,4,5,6-tetrahydro-1,3,5-triazine-2-carboxylic acid |
| LY333328 |
