Introduction:Basic information about CAS 88691-50-3|(2,4-DICHLORO-6-METHYLPYRIDIN-3-YL)METHANOL, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | (2,4-DICHLORO-6-METHYLPYRIDIN-3-YL)METHANOL |
|---|
| CAS Number | 88691-50-3 | Molecular Weight | 259.53700 |
|---|
| Density | 1.601 g/cm3 | Boiling Point | 350.6ºC at 760 mmHg |
|---|
| Molecular Formula | C7H5Cl3O2S | Melting Point | 83-85ºC |
|---|
| MSDS | USA | Flash Point | / |
|---|
| Symbol | GHS05 | Signal Word | Danger |
|---|
Names
| Name | (2,4-dichlorophenyl)methanesulfonyl chloride |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.601 g/cm3 |
|---|
| Boiling Point | 350.6ºC at 760 mmHg |
|---|
| Melting Point | 83-85ºC |
|---|
| Molecular Formula | C7H5Cl3O2S |
|---|
| Molecular Weight | 259.53700 |
|---|
| Exact Mass | 257.90800 |
|---|
| PSA | 42.52000 |
|---|
| LogP | 4.14280 |
|---|
| Index of Refraction | 1.589 |
|---|
| InChIKey | SNLHLLYEHFIELA-UHFFFAOYSA-N |
|---|
| SMILES | O=S(=O)(Cl)Cc1ccc(Cl)cc1Cl |
|---|
| Storage condition | 2-8℃ |
|---|
Safety Information
| Symbol | GHS05 |
|---|
| Signal Word | Danger |
|---|
| Hazard Statements | H314 |
|---|
| Supplemental HS | Reacts violently with water. |
|---|
| Precautionary Statements | P280-P305 + P351 + P338-P310 |
|---|
| Hazard Codes | C |
|---|
| Risk Phrases | 34 |
|---|
| Safety Phrases | 26-36/37/39-45 |
|---|
| RIDADR | UN 3261 |
|---|
| HS Code | 2904909090 |
|---|
Customs
| HS Code | 2904909090 |
|---|
| Summary | HS:2904909090 sulphonated, nitrated or nitrosated derivatives of hydrocarbons, whether or not halogenated VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
|---|
Synonyms
| (2,4-Dichlorophenyl)methylsulphonyl chloride |
| (2,4-dichloro-phenyl)-methanesulfonyl chloride |
| Benzenemethanesulfonylchloride,2,4-dichloro |
| (2,4-Dichlor-phenyl)-methansulfonylchlorid |
| 2,4-dichlorobenzylsulphonyl chloride |
| 2,4-Dichlorobenzylsulfonyl chloride |