Introduction：Basic information about CAS 6908-38-9|(4'-Fluoro-4-biphenylyl)acetic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | (4'-Fluoro-4-biphenylyl)acetic acid |
|---|
| CAS Number | 6908-38-9 | Molecular Weight | 230.234 |
|---|
| Density | 1.2±0.1 g/cm3 | Boiling Point | 386.9±30.0 °C at 760 mmHg |
|---|
| Molecular Formula | C14H11FO2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 187.8±24.6 °C |
|---|
Names
| Name | 2-[4-(4-fluorophenyl)phenyl]acetic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.2±0.1 g/cm3 |
|---|
| Boiling Point | 386.9±30.0 °C at 760 mmHg |
|---|
| Molecular Formula | C14H11FO2 |
|---|
| Molecular Weight | 230.234 |
|---|
| Flash Point | 187.8±24.6 °C |
|---|
| Exact Mass | 230.074310 |
|---|
| PSA | 37.30000 |
|---|
| LogP | 3.20 |
|---|
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
|---|
| Index of Refraction | 1.579 |
|---|
| InChIKey | HQQLXERSPFVWEW-UHFFFAOYSA-N |
|---|
| SMILES | O=C(O)Cc1ccc(-c2ccc(F)cc2)cc1 |
|---|
Safety Information
Customs
| HS Code | 2916399090 |
|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|---|
Synonyms
| 4'-Fluoro-biphenyl-4-acetic acid |
| [1,1'-Biphenyl]-4-acetic acid, 4'-fluoro- |
| [4-(4-Fluorophenyl)phenyl]acetic acid |
| 2-(4'-Fluorobiphenyl-4-yl)acetic acid |
| 2-(4'-Fluoro-[1,1'-biphenyl]-4-yl)acetic acid |
| 4'-Fluoro-[1,1'-Biphenyl]-4-Acetic Acid |
| (4'-Fluorobiphenyl-4-yl)acetic acid |
| 4-Biphenyl-4'-fluoro-aceticacid |
| (4'-Fluoro-4-biphenylyl)acetic acid |
| (4'-fluoro-biphenyl-4-yl)-acetic acid |
