Introduction：Basic information about CAS 899809-64-4|(E)-3-(5-nitrocyclohex-1-en-1-yl)acrylic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | (E)-3-(5-nitrocyclohex-1-en-1-yl)acrylic acid |
|---|
| CAS Number | 899809-64-4 | Molecular Weight | 197.188 |
|---|
| Density | 1.3±0.1 g/cm3 | Boiling Point | 415.8±34.0 °C at 760 mmHg |
|---|
| Molecular Formula | C9H11NO4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 184.9±14.1 °C |
|---|
Names
| Name | (E)-3-(5-nitrocyclohexen-1-yl)prop-2-enoic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.3±0.1 g/cm3 |
|---|
| Boiling Point | 415.8±34.0 °C at 760 mmHg |
|---|
| Molecular Formula | C9H11NO4 |
|---|
| Molecular Weight | 197.188 |
|---|
| Flash Point | 184.9±14.1 °C |
|---|
| Exact Mass | 197.068802 |
|---|
| PSA | 83.12000 |
|---|
| LogP | 1.19 |
|---|
| Vapour Pressure | 0.0±2.1 mmHg at 25°C |
|---|
| Index of Refraction | 1.553 |
|---|
| InChIKey | PEYXGOWSKLZBEO-SNAWJCMRSA-N |
|---|
| SMILES | O=C(O)C=CC1=CCCC([N+](=O)[O-])C1 |
|---|
Synonyms
| I14-8081 |
| (2E)-3-(5-Nitro-1-cyclohexen-1-yl)acrylic acid |
| (E)-3-(5-nitrocyclohex-1-en-1-yl)acrylic acid |
| 2-Propenoic acid, 3-(5-nitro-1-cyclohexen-1-yl)-, (2E)- |
| (2E)-3-(5-nitrocyclohex-1-enyl)acrylic acid |
