Introduction:Basic information about CAS 104145-95-1|cefditoren, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | cefditoren |
|---|
| CAS Number | 104145-95-1 | Molecular Weight | 506.57800 |
|---|
| Density | 1.75g/cm3 | Boiling Point | / |
|---|
| Molecular Formula | C19H18N6O5S3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | cefditoren |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.75g/cm3 |
|---|
| Molecular Formula | C19H18N6O5S3 |
|---|
| Molecular Weight | 506.57800 |
|---|
| Exact Mass | 506.05000 |
|---|
| PSA | 246.10000 |
|---|
| LogP | 2.00100 |
|---|
| Index of Refraction | 1.825 |
|---|
| InChIKey | KMIPKYQIOVAHOP-YLGJWRNMSA-N |
|---|
| SMILES | CON=C(C(=O)NC1C(=O)N2C(C(=O)O)=C(C=Cc3scnc3C)CSC12)c1csc(N)n1 |
|---|
Synonyms
| 3-[(Z)-1-(4-chloro-anilino)-ethylidene]-dihydro-furan-2-one |
| 3-[(Z)-2-(4-methyl-5-thiazolyl)vinyl]-7-[(Z)-(2-aminothiazolyl-4-yl)-2-(methoxyimino)acetamido]-3-cephem-4-carboxylic acid |
| Cefditoren acid |
| 2(3H)-Furanone,3-[1-[(4-chlorophenyl)amino]ethylidene]dihydro-,(Z) |
| [6R-[3(Z),6a,7b(Z)]]-7-[[(2-amino-4-thiazolyl)(methoxyimino)acetyl]amino]-3-[2-(4-methyl-5-thiazolyl)ethenyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-carboxylic acid |
| (6R)-7-[[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-3-[(Z)-2-(4-methyl-1,3-thiazol-5-yl)ethenyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
| 3-[1-(4-chloroanilino)ethylidene]dihydro-2(3H)-furanone |