Introduction：Basic information about CAS 119126-15-7|1-[4-chloro-3-(2,2,3,3,3-pentafluoropropoxymethyl)phenyl]-5-phenyl-1,2 ,4-triazole-3, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1-[4-chloro-3-(2,2,3,3,3-pentafluoropropoxymethyl)phenyl]-5-phenyl-1,2 ,4-triazole-3-carboxamide |
|---|
| CAS Number | 119126-15-7 | Molecular Weight | 460.78500 |
|---|
| Density | 1.49g/cm3 | Boiling Point | 555.7ºC at 760mmHg |
|---|
| Molecular Formula | C19H14ClF5N4O2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 289.9ºC |
|---|
Names
| Name | flupoxam |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.49g/cm3 |
|---|
| Boiling Point | 555.7ºC at 760mmHg |
|---|
| Molecular Formula | C19H14ClF5N4O2 |
|---|
| Molecular Weight | 460.78500 |
|---|
| Flash Point | 289.9ºC |
|---|
| Exact Mass | 460.07300 |
|---|
| PSA | 83.03000 |
|---|
| LogP | 5.10110 |
|---|
| Vapour Pressure | 2.18E-12mmHg at 25°C |
|---|
| Index of Refraction | 1.574 |
|---|
| InChIKey | AOQMRUTZEYVDIL-UHFFFAOYSA-N |
|---|
| SMILES | NC(=O)c1nc(-c2ccccc2)n(-c2ccc(Cl)c(COCC(F)(F)C(F)(F)F)c2)n1 |
|---|
Safety Information
| Hazard Codes | N: Dangerous for the environment; |
|---|
| Risk Phrases | R51/53 |
|---|
| Safety Phrases | 61 |
|---|
Synonyms
| Flupoxam |
| Flupoxam [ISO:BSI] |
| 1H-1,2,4-Triazole-3-carboxamide,1-(4-chloro-3-((2,2,3,3,3-pentafluoropropoxy)methyl)phenyl)-5-phenyl |
| 1-[4-chloro-3-(2,2,3,3,3-pentafluoropropoxymethyl)phenyl]-5-phenyl-1,2,4-triazole-3-carboxamide |
| 1-{4-chloro-3-[(2,2,3,3,3-pentafluoropropoxy)methyl]phenyl}-5-phenyl-1H-1,2,4-triazole-3-carboxamide |
| 1-[4-chloro-α-(2,2,3,3,3-pentafluoropropoxy)-m-tolyl]-5-phenyl-1H-1,2,4-triazole-3-carboxamide |
| 1-[3-(2,2,3,3,3-pentafluoropropoxy)-methyl-4-chloro]-phenyl-5-phenyl-1H-1,2,4-triazole-3-carboxamide |
| 1-[4-chloro-3-[(2,2,3,3,3-pentafluoropropoxy)methyl]phenyl]-5-phenyl-1H-1,2,4-triazole-3-carboxamide |
