Introduction：Basic information about CAS 50536-72-6|3H-Benz[e]indole-2-carboxylic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 3H-Benz[e]indole-2-carboxylic acid |
|---|
| CAS Number | 50536-72-6 | Molecular Weight | 211.21600 |
|---|
| Density | 1.422g/cm3 | Boiling Point | 513.7ºC at 760 mmHg |
|---|
| Molecular Formula | C13H9NO2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 264.5ºC |
|---|
Names
| Name | 3H-Benzo[e]indole-2-carboxylic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.422g/cm3 |
|---|
| Boiling Point | 513.7ºC at 760 mmHg |
|---|
| Molecular Formula | C13H9NO2 |
|---|
| Molecular Weight | 211.21600 |
|---|
| Flash Point | 264.5ºC |
|---|
| Exact Mass | 211.06300 |
|---|
| PSA | 53.09000 |
|---|
| LogP | 3.01930 |
|---|
| Index of Refraction | 1.796 |
|---|
| InChIKey | PZHFTOALJLZERX-UHFFFAOYSA-N |
|---|
| SMILES | O=C(O)c1cc2c(ccc3ccccc32)[nH]1 |
|---|
Synonyms
| 3H-Benz[e]indol-2-carbonsaeure |
| benz[e]indole-2-carboxylic acid |
| 3H-benz[e]indole-2-carboxylic acid |
