Introduction：Basic information about CAS 1020714-78-6|3-Azido-2-(benzoyloxy)propanoic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 3-Azido-2-(benzoyloxy)propanoic acid |
|---|
| CAS Number | 1020714-78-6 | Molecular Weight | 235.19600 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C10H9N3O4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | 3-Azido-2-(benzoyloxy)propanoic acid |
|---|
Chemical & Physical Properties
| Molecular Formula | C10H9N3O4 |
|---|
| Molecular Weight | 235.19600 |
|---|
| Exact Mass | 235.05900 |
|---|
| PSA | 113.35000 |
|---|
| LogP | 1.05966 |
|---|
| InChIKey | VLDOQDQFTOPSBS-UHFFFAOYSA-N |
|---|
| SMILES | [N-]=[N+]=NCC(OC(=O)c1ccccc1)C(=O)O |
|---|
Safety Information
Customs
| HS Code | 2929909090 |
|---|
| Summary | 2929909090 other compounds with other nitrogen function VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|---|
