Introduction:Basic information about CAS 10605-24-0|2-methyl-2-propylpropane-1,3-diyl dinitrate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-methyl-2-propylpropane-1,3-diyl dinitrate |
|---|
| CAS Number | 10605-24-0 | Molecular Weight | 222.19600 |
|---|
| Density | 1.218g/cm3 | Boiling Point | 283.5ºC at 760mmHg |
|---|
| Molecular Formula | C7H14N2O6 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 115.5ºC |
|---|
Names
| Name | [2-methyl-2-(nitrooxymethyl)pentyl] nitrate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.218g/cm3 |
|---|
| Boiling Point | 283.5ºC at 760mmHg |
|---|
| Molecular Formula | C7H14N2O6 |
|---|
| Molecular Weight | 222.19600 |
|---|
| Flash Point | 115.5ºC |
|---|
| Exact Mass | 222.08500 |
|---|
| PSA | 110.10000 |
|---|
| LogP | 2.25580 |
|---|
| Vapour Pressure | 0.00541mmHg at 25°C |
|---|
| Index of Refraction | 1.46 |
|---|
| InChIKey | BLJBDLGFKNXUCB-UHFFFAOYSA-N |
|---|
| SMILES | CCCC(C)(CO[N+](=O)[O-])CO[N+](=O)[O-] |
|---|
Safety Information
Customs
| HS Code | 2920909090 |
|---|
| Summary | 2920909090 esters of other inorganic acids of non-metals (excluding esters of hydrogen halides) and their salts; their halogenated, sulphonated, nitrated or nitrosated derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
|---|
Synonyms
| 1,3-Propanediol,2-methyl-2-propyl-,1,3-dinitrate |
| 2-Methyl-2-propyl-1,3-propanedioldinitrate |
| 1,3-Propanediol,2-methyl-2-n-propyl-,dinitrate |
| 2-Methyl-2-propylpropane-1,3-diyl dinitrate |
| EINECS 234-233-6 |
| 2-Methyl-2-n-propyl-1,3-propanediol dinitrate |
| Nitral |