Introduction:Basic information about CAS 171284-84-7|(3R,7aS)-3-(tert-butyl)dihydro-1H,3H-pyrrolo[1,2-c]oxazole-1,5(6H)-dione, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | (3R,7aS)-3-(tert-butyl)dihydro-1H,3H-pyrrolo[1,2-c]oxazole-1,5(6H)-dione |
|---|
| CAS Number | 171284-84-7 | Molecular Weight | 197.231 |
|---|
| Density | 1.2±0.1 g/cm3 | Boiling Point | 376.2±31.0 °C at 760 mmHg |
|---|
| Molecular Formula | C10H15NO3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 181.3±24.8 °C |
|---|
Names
| Name | (3R,7aS)-3-tert-butyl-3,6,7,7a-tetrahydropyrrolo[1,2-c][1,3]oxazole-1,5-dione |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.2±0.1 g/cm3 |
|---|
| Boiling Point | 376.2±31.0 °C at 760 mmHg |
|---|
| Molecular Formula | C10H15NO3 |
|---|
| Molecular Weight | 197.231 |
|---|
| Flash Point | 181.3±24.8 °C |
|---|
| Exact Mass | 197.105194 |
|---|
| PSA | 46.61000 |
|---|
| LogP | -0.90 |
|---|
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
|---|
| Index of Refraction | 1.518 |
|---|
| InChIKey | XKHXNEYLUYSDJF-IMTBSYHQSA-N |
|---|
| SMILES | CC(C)(C)C1OC(=O)C2CCC(=O)N21 |
|---|
Synonyms
| T55 ANV FVOTJ HX1&1&1 &&(3R,7aS)- Form |
| (3R,7aS)-3-(2-Methyl-2-propanyl)dihydro-1H-pyrrolo[1,2-c][1,3]oxazole-1,5(6H)-dione |
| 1H,3H-Pyrrolo[1,2-c]oxazole-1,5(6H)-dione, 3-(1,1-dimethylethyl)dihydro-, (3R,7aS)- |
| (3R,7aS)-3-tert-butyldihydro-1H-pyrrolo[1,2-c][1,3]oxazole-1,5(6H)-dione |
| 7291077 |
| (3R,7aS)-3-(tert-Butyl)dihydro-1H,3H-pyrrolo[1,2-c]oxazole-1,5(6H)-dione |
| (3R,7aS)-3-(tert-Butyl)dihydropyrrolo[1,2-c]oxazole-1,5(3H,6H)-dione |