Introduction:Basic information about CAS 178556-79-1|5-(4-(Trifluoromethyl)phenyl)-4H-1,2,4-triazol-3-amine, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 5-(4-(Trifluoromethyl)phenyl)-4H-1,2,4-triazol-3-amine |
|---|
| CAS Number | 178556-79-1 | Molecular Weight | 228.17400 |
|---|
| Density | 1.469 | Boiling Point | 390.607ºC at 760 mmHg |
|---|
| Molecular Formula | C9H7F3N4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | 5-[4-(trifluoromethyl)phenyl]-1H-1,2,4-triazol-3-amine |
|---|
Chemical & Physical Properties
| Density | 1.469 |
|---|
| Boiling Point | 390.607ºC at 760 mmHg |
|---|
| Molecular Formula | C9H7F3N4 |
|---|
| Molecular Weight | 228.17400 |
|---|
| Exact Mass | 228.06200 |
|---|
| PSA | 68.32000 |
|---|
| LogP | 2.00280 |
|---|
| Vapour Pressure | 0mmHg at 25°C |
|---|
| Index of Refraction | 1.566 |
|---|
| InChIKey | OPCMOBZOGLGRKI-UHFFFAOYSA-N |
|---|
| SMILES | Nc1n[nH]c(-c2ccc(C(F)(F)F)cc2)n1 |
|---|