Introduction:Basic information about CAS 24228-40-8|Ethyl 1-benzyl-4-piperidinecarboxylate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Ethyl 1-benzyl-4-piperidinecarboxylate |
|---|
| CAS Number | 24228-40-8 | Molecular Weight | 247.333 |
|---|
| Density | 1.1±0.1 g/cm3 | Boiling Point | 327.0±35.0 °C at 760 mmHg |
|---|
| Molecular Formula | C15H21NO2 | Melting Point | 120-119ºC |
|---|
| MSDS | USA | Flash Point | 110.7±16.8 °C |
|---|
| Symbol | GHS06 | Signal Word | Danger |
|---|
Names
| Name | ethyl 1-benzylpiperidine-4-carboxylate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.1±0.1 g/cm3 |
|---|
| Boiling Point | 327.0±35.0 °C at 760 mmHg |
|---|
| Melting Point | 120-119ºC |
|---|
| Molecular Formula | C15H21NO2 |
|---|
| Molecular Weight | 247.333 |
|---|
| Flash Point | 110.7±16.8 °C |
|---|
| Exact Mass | 247.157227 |
|---|
| PSA | 29.54000 |
|---|
| LogP | 2.56 |
|---|
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
|---|
| Index of Refraction | 1.533 |
|---|
| InChIKey | ASQCOPJFYLJCGD-UHFFFAOYSA-N |
|---|
| SMILES | CCOC(=O)C1CCN(Cc2ccccc2)CC1 |
|---|
Safety Information
| Symbol | GHS06 |
|---|
| Signal Word | Danger |
|---|
| Hazard Statements | H301 |
|---|
| Precautionary Statements | P301 + P310 |
|---|
| Hazard Codes | Xi: Irritant; |
|---|
| Risk Phrases | R36/37/38 |
|---|
| Safety Phrases | S24/25 |
|---|
| RIDADR | UN 2810 6.1 / PGIII |
|---|
| HS Code | 2933399090 |
|---|
Customs
| HS Code | 2933399090 |
|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|---|
Synonyms
| Ethyl 1-benzyl-4-piperidinecarboxylate |
| 1-Benzylpiperidine-4-carboxylic acid ethyl ester |
| Ethyl 1-benzylpiperidine-4-carboxylate |
| 4-ethoxycarbonyl-1-benzyl piperidine |
| ethyl n-benzyl-isonipecotate |
| EINECS 246-094-9 |
| 1-benzyl-4-piperidinecarboxylic acid ethyl ester |
| N-Benzyl-4-carboethoxypiperidine |
| 1-benzylpiperidine-4-ethyl carboxylate |
| ethyl 1-benzyl-piperidine-4-carboxylate |
| 1-Benzylisonipecotic Acid Ethyl Ester |
| Ethyl 1-Benzylisonipecotate |
| MFCD00040748 |
| Ethyl N-benzylpiperidine-4-carboxylate |
| 1-BENZYL-4-CARBOETHOXYPIPERIDINE |
| 4-Piperidinecarboxylic acid, 1-(phenylmethyl)-, ethyl ester |
| Ethyl N-benzyl-4-piperidinecarboxylate |