Introduction：Basic information about CAS 66841-26-7|tralocythrin, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | tralocythrin |
|---|
| CAS Number | 66841-26-7 | Molecular Weight | 576.10500 |
|---|
| Density | 1.618g/cm3 | Boiling Point | 564.9ºC at 760 mmHg |
|---|
| Molecular Formula | C22H19Br2Cl2NO3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 295.4ºC |
|---|
Names
| Name | tralocythrin |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.618g/cm3 |
|---|
| Boiling Point | 564.9ºC at 760 mmHg |
|---|
| Molecular Formula | C22H19Br2Cl2NO3 |
|---|
| Molecular Weight | 576.10500 |
|---|
| Flash Point | 295.4ºC |
|---|
| Exact Mass | 572.91100 |
|---|
| PSA | 59.32000 |
|---|
| LogP | 7.14878 |
|---|
| Index of Refraction | 1.613 |
|---|
| InChIKey | VQHJWDTTWVEXFE-UHFFFAOYSA-N |
|---|
| SMILES | CC1(C)C(C(=O)OC(C#N)c2cccc(Oc3ccccc3)c2)C1C(Br)C(Cl)(Cl)Br |
|---|
Synonyms
| (Ξ)-cyano(3-phenoxyphenyl)methyl (1Ξ,3Ξ)-3-[(1Ξ)-1,2-dibromo-2,2-dichloroethyl]-2,2-dimethylcyclopropane-1-carboxyate |
| 1RS,3SR)-3-[(RS)-1,2-dibromo-2,2-dichloroethyl]-2,2-dimethylcyclopropanecarboxyate |
| cyano(3-phenoxyphenyl)methyl 3-(1,2-dibromo-2,2-dichloroethyl)-2,2-dimethylcyclopropanecarboxyate |
| (RS)-α-cyano-3-phenoxybenzyl (1RS,3RS |
| [cyano-(3-phenoxyphenyl)methyl] 3-(1,2-dibromo-2,2-dichloroethyl)-2,2-dimethylcyclopropane-1-carboxylate |
| Tralocythrin |
| (RS)-α-cyano-3-phenoxybenzyl (1RS)-cis-trans-3-[(RS)-1,2-dibromo-2,2-dichloroethyl]-2,2-dimethylcyclopropanecarboxyate |
