Introduction:Basic information about CAS 69192-23-0|prochloraz-manganese, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | prochloraz-manganese |
|---|
| CAS Number | 69192-23-0 | Molecular Weight | 879.17500 |
|---|
| Density | / | Boiling Point | 499.8ºC at 760 mmHg |
|---|
| Molecular Formula | C30H32Cl8MnN6O4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 256.1ºC |
|---|
Names
| Name | prochloraz-manganese |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Boiling Point | 499.8ºC at 760 mmHg |
|---|
| Molecular Formula | C30H32Cl8MnN6O4 |
|---|
| Molecular Weight | 879.17500 |
|---|
| Flash Point | 256.1ºC |
|---|
| Exact Mass | 874.93700 |
|---|
| PSA | 94.72000 |
|---|
| LogP | 3.21280 |
|---|
| InChIKey | CERKEZZZEAJIBS-UHFFFAOYSA-L |
|---|
| SMILES | CCCN(CCOc1c(Cl)cc(Cl)cc1Cl)C(=O)n1ccnc1.CCCN(CCOc1c(Cl)cc(Cl)cc1Cl)C(=O)n1ccnc1.Cl[Mn]Cl |
|---|
Synonyms
| Prochloraz manganese complex |
| prochloraz-Mn |
| EINECS 273-907-4 |
| Prochloraz Mn |
| dichloromanganese,N-propyl-N-[2-(2,4,6-trichlorophenoxy)ethyl]imidazole-1-carboxamide |
| N-propyl-N-[2-(2,4,6-trichlorophenoxy)ethyl]imidazole-1-carboxamide complex with manganese(II) chloride (2:1) |
| dichlorobis[N-propyl-N-[2-(2,4,6-trichlorophenoxy)ethyl]-1H-imidazole-1-carboxamide-κO1]manganese |
| CQ 1054 |