Introduction：Basic information about CAS 480444-13-1|(S)-1-TOSYLOXY-3-BUTEN-1-OL, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | (S)-1-TOSYLOXY-3-BUTEN-1-OL |
|---|
| CAS Number | 480444-13-1 | Molecular Weight | 253.38200 |
|---|
| Density | 0.988g/cm3 | Boiling Point | 359.5ºC at 760 mmHg |
|---|
| Molecular Formula | C18H23N | Melting Point | 50-53ºC(lit.) |
|---|
| MSDS | / | Flash Point | 162.4ºC |
|---|
Names
| Name | 3,3-dimethyl-1,1-diphenylbutan-2-amine |
|---|
Chemical & Physical Properties
| Density | 0.988g/cm3 |
|---|
| Boiling Point | 359.5ºC at 760 mmHg |
|---|
| Melting Point | 50-53ºC(lit.) |
|---|
| Molecular Formula | C18H23N |
|---|
| Molecular Weight | 253.38200 |
|---|
| Flash Point | 162.4ºC |
|---|
| Exact Mass | 253.18300 |
|---|
| PSA | 26.02000 |
|---|
| LogP | 4.89220 |
|---|
| Index of Refraction | 1.554 |
|---|
| InChIKey | ZZRLMXUCFVPFGS-UHFFFAOYSA-N |
|---|
| SMILES | CC(C)(C)C(N)C(c1ccccc1)c1ccccc1 |
|---|
